Products 3535-30-6
CAS 3535-30-6 appears in our catalog under these names: 4-Ethoxy-3-methoxybenzoic acid, 98%, 4-Ethoxy-3-methoxybenzoic acid, 4-Ethoxy-3-methoxybenzoic acid, 95%, 95%, 4-Ethoxy-3-methoxy-benzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100g, 50g, 100mg, 250mg.
4-ethoxy-3-methoxybenzoic acid (CAS 3535-30-6) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 4-ethoxy-3-methoxybenzoic acid. InChIKey: LBYKODYNFRCBIR-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 4-ethoxy-3-methoxybenzoic acid |
| InChIKey | LBYKODYNFRCBIR-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)O)OC |
Computed by PubChem (NCBI)