CAS 353770-03-3 is the registry number for 2-(N-cyclopropylcarbamoyl)cyclohexanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 25g, 10g.
2-(cyclopropylcarbamoyl)cyclohexane-1-carboxylic acid (CAS 353770-03-3) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: 2-(cyclopropylcarbamoyl)cyclohexane-1-carboxylic acid. InChIKey: NESTZIIAJPVBHN-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 2-(cyclopropylcarbamoyl)cyclohexane-1-carboxylic acid |
| InChIKey | NESTZIIAJPVBHN-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)C(=O)NC2CC2)C(=O)O |
Computed by PubChem (NCBI)