Products 353770-03-3

CAS 353770-03-3 is the registry number for 2-(N-cyclopropylcarbamoyl)cyclohexanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 25g, 10g.

Structural formula: {0} (CAS {1})

2-(cyclopropylcarbamoyl)cyclohexane-1-carboxylic acid (CAS 353770-03-3) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: 2-(cyclopropylcarbamoyl)cyclohexane-1-carboxylic acid. InChIKey: NESTZIIAJPVBHN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO3
Molecular weight211.26 g/mol
IUPAC name2-(cyclopropylcarbamoyl)cyclohexane-1-carboxylic acid
InChIKeyNESTZIIAJPVBHN-UHFFFAOYSA-N
SMILESC1CCC(C(C1)C(=O)NC2CC2)C(=O)O

Computed by PubChem (NCBI)