CAS 354153-63-2 is the registry number for (S)-2-Amino-2-mesitylethanol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-2-amino-2-(2,4,6-trimethylphenyl)ethanol (CAS 354153-63-2) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: (2S)-2-amino-2-(2,4,6-trimethylphenyl)ethanol. InChIKey: OUGDZOJXPDNULU-SNVBAGLBSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | (2S)-2-amino-2-(2,4,6-trimethylphenyl)ethanol |
| InChIKey | OUGDZOJXPDNULU-SNVBAGLBSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)[C@@H](CO)N)C |
Computed by PubChem (NCBI)