CAS 924265-80-5 is the registry number for (R)-2-Amino-2-(2,4,6-trimethylphenyl)ethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2R)-2-amino-2-(2,4,6-trimethylphenyl)ethanol (CAS 924265-80-5) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: (2R)-2-amino-2-(2,4,6-trimethylphenyl)ethanol. InChIKey: OUGDZOJXPDNULU-JTQLQIEISA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | (2R)-2-amino-2-(2,4,6-trimethylphenyl)ethanol |
| InChIKey | OUGDZOJXPDNULU-JTQLQIEISA-N |
| SMILES | CC1=CC(=C(C(=C1)C)[C@H](CO)N)C |
Computed by PubChem (NCBI)