CAS 3542-44-7 appears in our catalog under these names: Sodium 3-hydroxypropane-1-sulphonate, 98%, 3–Hydroxy–1–propanesulfonic acid sodium salt, Sodium 3-hydroxypropane-1-sulphonate 98%, 3-HYDROXY-1-PROPANESULFONIC ACID, SODIUM, 3-HYDROXY-1-PROPANESULFONIC ACID, SODIU&. Offered by: AmBeed, GLPBio, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 50g.
Sodium 3-hydroxypropane-1-sulfonate (CAS 3542-44-7) is a chemical compound with the molecular formula C3H7NaO4S and a molecular weight of 162.14 g/mol. IUPAC name: sodium 3-hydroxypropane-1-sulfonate. InChIKey: CSKVLUWCGPWCQR-UHFFFAOYSA-M.
| Molecular formula | C3H7NaO4S |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | sodium 3-hydroxypropane-1-sulfonate |
| InChIKey | CSKVLUWCGPWCQR-UHFFFAOYSA-M |
| SMILES | C(CO)CS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)