Products 52096-25-0
CAS 52096-25-0 appears in our catalog under these names: Sodium isopropyl sulfate, Sodium isopropyl sulfate, 97%, 97%, Sodium isopropyl sulfate, 97%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
Sodium propan-2-yl sulfate (CAS 52096-25-0) is a chemical compound with the molecular formula C3H7NaO4S and a molecular weight of 162.14 g/mol. IUPAC name: sodium propan-2-yl sulfate. InChIKey: YHVRBEAAJOBGSQ-UHFFFAOYSA-M.
| Molecular formula | C3H7NaO4S |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | sodium propan-2-yl sulfate |
| InChIKey | YHVRBEAAJOBGSQ-UHFFFAOYSA-M |
| SMILES | CC(C)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)