CAS 540-92-1 appears in our catalog under these names: Acetone sodium bisulfite, 97%, Sodium 2–hydroxypropane–2–sulfonate, 2-Hydroxy-2-propanesulfonic acid monosodium salt, 97% , 2-Hydroxy-2-propanesulfonic acid monosodium salt. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 25g, 100g, 500g, 1g, 5g, 1000g.
Sodium 2-hydroxypropane-2-sulfonate (CAS 540-92-1) is a chemical compound with the molecular formula C3H7NaO4S and a molecular weight of 162.14 g/mol. IUPAC name: sodium 2-hydroxypropane-2-sulfonate. InChIKey: YNJORDSKPXMABC-UHFFFAOYSA-M.
| Molecular formula | C3H7NaO4S |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | sodium 2-hydroxypropane-2-sulfonate |
| InChIKey | YNJORDSKPXMABC-UHFFFAOYSA-M |
| SMILES | CC(C)(O)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)