Products 354574-21-3

CAS 354574-21-3 is the registry number for 7-Methoxy-2-methyl-1H-indole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

7-methoxy-2-methyl-1H-indole-3-carboxylic acid (CAS 354574-21-3) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 7-methoxy-2-methyl-1H-indole-3-carboxylic acid. InChIKey: ARJNLHYCQMPIAN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO3
Molecular weight205.21 g/mol
IUPAC name7-methoxy-2-methyl-1H-indole-3-carboxylic acid
InChIKeyARJNLHYCQMPIAN-UHFFFAOYSA-N
SMILESCC1=C(C2=C(N1)C(=CC=C2)OC)C(=O)O

Computed by PubChem (NCBI)