Products 35481-77-7
CAS 35481-77-7 appears in our catalog under these names: Corianin, Corianin, ≥98%, ≥98%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
1,5-dihydroxy-13-methyl-14-prop-1-en-2-yl-3,7,10-trioxapentacyclo[6.4.1.19,12.02,4.05,13]tetradecan-11-one (CAS 35481-77-7) is a chemical compound with the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. IUPAC name: 1,5-dihydroxy-13-methyl-14-prop-1-en-2-yl-3,7,10-trioxapentacyclo[6.4.1.19,12.02,4.05,13]tetradecan-11-one. InChIKey: IKTUZVAVHCTHSU-UHFFFAOYSA-N.
| Molecular formula | C15H18O6 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 1,5-dihydroxy-13-methyl-14-prop-1-en-2-yl-3,7,10-trioxapentacyclo[6.4.1.19,12.02,4.05,13]tetradecan-11-one |
| InChIKey | IKTUZVAVHCTHSU-UHFFFAOYSA-N |
| SMILES | CC(=C)C1C2C3C4(C(CO3)(C5C(C4(C1C(=O)O2)O)O5)O)C |
Computed by PubChem (NCBI)