Products 247942-73-0

CAS 247942-73-0 is the registry number for 2,4,6-Triethylbenzene-1,3,5-tricarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,4,6-triethylbenzene-1,3,5-tricarboxylic acid (CAS 247942-73-0) is a chemical compound with the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. IUPAC name: 2,4,6-triethylbenzene-1,3,5-tricarboxylic acid. InChIKey: QTSXVDLMBUFQFE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18O6
Molecular weight294.30 g/mol
IUPAC name2,4,6-triethylbenzene-1,3,5-tricarboxylic acid
InChIKeyQTSXVDLMBUFQFE-UHFFFAOYSA-N
SMILESCCC1=C(C(=C(C(=C1C(=O)O)CC)C(=O)O)CC)C(=O)O

Computed by PubChem (NCBI)