CAS 247942-73-0 is the registry number for 2,4,6-Triethylbenzene-1,3,5-tricarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-triethylbenzene-1,3,5-tricarboxylic acid (CAS 247942-73-0) is a chemical compound with the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. IUPAC name: 2,4,6-triethylbenzene-1,3,5-tricarboxylic acid. InChIKey: QTSXVDLMBUFQFE-UHFFFAOYSA-N.
| Molecular formula | C15H18O6 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 2,4,6-triethylbenzene-1,3,5-tricarboxylic acid |
| InChIKey | QTSXVDLMBUFQFE-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C(=C1C(=O)O)CC)C(=O)O)CC)C(=O)O |
Computed by PubChem (NCBI)