Products 40207-09-8

CAS 40207-09-8 is the registry number for (3,5-Bis-carboxymethyl-2,4,6-trimethyl-phenyl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[3,5-bis(carboxymethyl)-2,4,6-trimethylphenyl]acetic acid (CAS 40207-09-8) is a chemical compound with the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. IUPAC name: 2-[3,5-bis(carboxymethyl)-2,4,6-trimethylphenyl]acetic acid. InChIKey: DCUDJNRYVIOFHP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18O6
Molecular weight294.30 g/mol
IUPAC name2-[3,5-bis(carboxymethyl)-2,4,6-trimethylphenyl]acetic acid
InChIKeyDCUDJNRYVIOFHP-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=C1CC(=O)O)C)CC(=O)O)C)CC(=O)O

Computed by PubChem (NCBI)