CAS 4105-92-4 appears in our catalog under these names: Triethyl benzene-1,3,5-tricarboxylate, 97%, Triethyl 1,3,5–benzenetricarboxylate, Triethyl 1,3,5-benzenetricarboxylate, 97% , Triethyl benzene-1,3,5-tricarboxylate 98%, Triethyl benzene-1,3,5-tricarboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 100g, 25g, 15g.
Triethyl benzene-1,3,5-tricarboxylate (CAS 4105-92-4) is a chemical compound with the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. IUPAC name: triethyl benzene-1,3,5-tricarboxylate. InChIKey: KXGOWZRHSOJOLF-UHFFFAOYSA-N.
| Molecular formula | C15H18O6 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | triethyl benzene-1,3,5-tricarboxylate |
| InChIKey | KXGOWZRHSOJOLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)