CAS 354812-80-9 is the registry number for 4-(3-Bromophenyl)-3a,4,5,9b-tetrahydro-3h-cyclopenta[c]quinoline-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4-(3-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid (CAS 354812-80-9) is a chemical compound with the molecular formula C19H16BrNO2 and a molecular weight of 370.2 g/mol. IUPAC name: 4-(3-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid. InChIKey: VXYQVSHWFNVJAE-UHFFFAOYSA-N.
| Molecular formula | C19H16BrNO2 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | 4-(3-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid |
| InChIKey | VXYQVSHWFNVJAE-UHFFFAOYSA-N |
| SMILES | C1C=CC2C1C(NC3=C2C=CC=C3C(=O)O)C4=CC(=CC=C4)Br |
Computed by PubChem (NCBI)