CAS 65473-91-8 appears in our catalog under these names: Ethyl 5-(4-bromophenyl)-2-phenyl-1h-pyrrole-3-carboxylate, 95%, Ethyl 5-(4-bromophenyl)-2-phenylpyrrole-3-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2g, 5g, 10g.
Ethyl 5-(4-bromophenyl)-2-phenyl-1H-pyrrole-3-carboxylate (CAS 65473-91-8) is a chemical compound with the molecular formula C19H16BrNO2 and a molecular weight of 370.2 g/mol. IUPAC name: ethyl 5-(4-bromophenyl)-2-phenyl-1H-pyrrole-3-carboxylate. InChIKey: UKQFMOLPXRFZKK-UHFFFAOYSA-N.
| Molecular formula | C19H16BrNO2 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | ethyl 5-(4-bromophenyl)-2-phenyl-1H-pyrrole-3-carboxylate |
| InChIKey | UKQFMOLPXRFZKK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C1)C2=CC=C(C=C2)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)