CAS 376374-34-4 is the registry number for 8-Bromo-2-(4-methoxyphenyl)-2,3-dihydro-1h-naphtho[1,2-e][1,3]oxazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
8-bromo-2-(4-methoxyphenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine (CAS 376374-34-4) is a chemical compound with the molecular formula C19H16BrNO2 and a molecular weight of 370.2 g/mol. IUPAC name: 8-bromo-2-(4-methoxyphenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine. InChIKey: XFSBDBIEVKXTPM-UHFFFAOYSA-N.
| Molecular formula | C19H16BrNO2 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | 8-bromo-2-(4-methoxyphenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine |
| InChIKey | XFSBDBIEVKXTPM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2CC3=C(C=CC4=C3C=CC(=C4)Br)OC2 |
Computed by PubChem (NCBI)