CAS 354815-90-0 appears in our catalog under these names: 3A,4,5,9B-Tetrahydro-3h-cyclopenta[c]quinoline-4-carboxylic acid, 95%, MurA-IN-1, 97%, MurA–IN–1, MurA-IN-1, 99.32%. Offered by: Combi-blocks, AmBeed, GLPBio, MedChemExpress. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 100 mg, 10mM/1mL.
3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid (CAS 354815-90-0) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid. InChIKey: WRJCENKZISEXPF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
| InChIKey | WRJCENKZISEXPF-UHFFFAOYSA-N |
| SMILES | C1C=CC2C1C(NC3=CC=CC=C23)C(=O)O |
Computed by PubChem (NCBI)