Products 354818-43-2
CAS 354818-43-2 is the registry number for (1R,3s,5S)-8-tert-Butyl 3-ethyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
8-O-tert-butyl 3-O-ethyl (1R,5S)-8-azabicyclo[3.2.1]octane-3,8-dicarboxylate (CAS 354818-43-2) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: 8-O-tert-butyl 3-O-ethyl (1R,5S)-8-azabicyclo[3.2.1]octane-3,8-dicarboxylate. InChIKey: WPOGOHLOBGPUEJ-YOGCLGLASA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | 8-O-tert-butyl 3-O-ethyl (1R,5S)-8-azabicyclo[3.2.1]octane-3,8-dicarboxylate |
| InChIKey | WPOGOHLOBGPUEJ-YOGCLGLASA-N |
| SMILES | CCOC(=O)C1C[C@H]2CC[C@@H](C1)N2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)