Products 354999-94-3
CAS 354999-94-3 is the registry number for N-(3,4-dimethylphenyl)-1-oxoisochromene-3-carboxamide, ≥98%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
N-(3,4-dimethylphenyl)-1-oxoisochromene-3-carboxamide (CAS 354999-94-3) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: N-(3,4-dimethylphenyl)-1-oxoisochromene-3-carboxamide. InChIKey: SPKVDCZBIWCMTN-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | N-(3,4-dimethylphenyl)-1-oxoisochromene-3-carboxamide |
| InChIKey | SPKVDCZBIWCMTN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC3=CC=CC=C3C(=O)O2)C |
Computed by PubChem (NCBI)