cas: 355-28-2 — see every product listed under this CAS number, including other names
1H,1H-Nonafluoro-1-pentanol, >97.0%(GC) (CAS 355-28-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0810-1G |
| cas | 355-28-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 251.11 Pln | |
| TCI | 5g | 742.84 Pln | |
| TCI | 25g | 2340.94 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol (CAS 355-28-2) is a chemical compound with the molecular formula C5H3F9O and a molecular weight of 250.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol. InChIKey: PJRIQFXPYMVWOU-UHFFFAOYSA-N.
| Molecular formula | C5H3F9O |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol |
| InChIKey | PJRIQFXPYMVWOU-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)