CAS 35582-13-9 is the registry number for 3-(1,3-Thiazol-2-yl)phenol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(1,3-thiazol-2-yl)phenol (CAS 35582-13-9) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 3-(1,3-thiazol-2-yl)phenol. InChIKey: FSOFDTPOJDKPQV-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 3-(1,3-thiazol-2-yl)phenol |
| InChIKey | FSOFDTPOJDKPQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=NC=CS2 |
Computed by PubChem (NCBI)