CAS 35590-69-3 is the registry number for (3S,6S)-3-((2S)-Butan-2-yl)-6-methylpiperazine-2,5-dione. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 250mg.
Cyclo(Ala-Ile) is an organonitrogen compound and an organooxygen compound. It is functionally related to an alpha-amino acid.
Source: ChEBI
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | (3S,6S)-3-[(2S)-butan-2-yl]-6-methylpiperazine-2,5-dione |
| InChIKey | JDRIJDPCYNFZIT-ACZMJKKPSA-N |
| SMILES | CC[C@H](C)[C@H]1C(=O)N[C@H](C(=O)N1)C |
Computed by PubChem (NCBI)