Products 35590-70-6
CAS 35590-70-6 is the registry number for (3S,6R)-3-((2S)-Butan-2-yl)-6-methylpiperazine-2,5-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S,6R)-3-[(2S)-butan-2-yl]-6-methylpiperazine-2,5-dione (CAS 35590-70-6) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: (3S,6R)-3-[(2S)-butan-2-yl]-6-methylpiperazine-2,5-dione. InChIKey: JDRIJDPCYNFZIT-XVMARJQXSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | (3S,6R)-3-[(2S)-butan-2-yl]-6-methylpiperazine-2,5-dione |
| InChIKey | JDRIJDPCYNFZIT-XVMARJQXSA-N |
| SMILES | CC[C@H](C)[C@H]1C(=O)N[C@@H](C(=O)N1)C |
Computed by PubChem (NCBI)