CAS 35657-40-0 appears in our catalog under these names: [(tert-Butoxy)carbonyl]amino 2,2-dimethylpropanoate, 95%, tert-Butyl pivaloyloxycarbamate, 95%, [(1,1-Dimethylethoxy)carbonyl]azanyl 2,2-dimethylpropanoate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, 10g.
[(2-methylpropan-2-yl)oxycarbonylamino] 2,2-dimethylpropanoate (CAS 35657-40-0) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: [(2-methylpropan-2-yl)oxycarbonylamino] 2,2-dimethylpropanoate. InChIKey: WYAROZBFQHEKEG-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | [(2-methylpropan-2-yl)oxycarbonylamino] 2,2-dimethylpropanoate |
| InChIKey | WYAROZBFQHEKEG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)ONC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)