CAS 35690-69-8 appears in our catalog under these names: 3-(Aminomethyl)isobenzofuran-1(3H)-one hydrochloride, 98%, 3-Aminomethylphthalide hydrochloride, 3-(Aminomethyl)isobenzofuran-1(3H)-one hydrochloride, 97%, 97%, 3-(Aminomethyl)isobenzofuran-1(3H)-one hydrochloride, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 25mg, 100mg, 250mg, 500mg, 1g.
3-(aminomethyl)-3H-2-benzofuran-1-one;hydrochloride (CAS 35690-69-8) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 3-(aminomethyl)-3H-2-benzofuran-1-one;hydrochloride. InChIKey: XANVOYITPANLGX-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 3-(aminomethyl)-3H-2-benzofuran-1-one;hydrochloride |
| InChIKey | XANVOYITPANLGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(OC2=O)CN.Cl |
Computed by PubChem (NCBI)