CAS 35692-94-5 appears in our catalog under these names: 4-Hydroxy-beta-cyclocitral, 4–Hydroxy–β–cyclocitral. Offered by: TRC, GLPBio. Available pack sizes: 50mg, 25mg.
(2E,4E)-5-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienal (CAS 35692-94-5) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (2E,4E)-5-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienal. InChIKey: YMYPOEDCYSNBAO-LCAICKDSSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (2E,4E)-5-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienal |
| InChIKey | YMYPOEDCYSNBAO-LCAICKDSSA-N |
| SMILES | CC1=C(C(CC(C1)O)(C)C)/C=C/C(=C/C=O)/C |
Computed by PubChem (NCBI)