Products 535950-02-8
CAS 535950-02-8 is the registry number for (2E,4E)-5-(4-Hydroxy-2,6,6-trimethyl-1-cyclohexen-1-yl)-3-methyl-2,4-pentadienal. Offered by: TRC. Available pack sizes: 100mg.
(2E,4E)-5-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienal (CAS 535950-02-8) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (2E,4E)-5-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienal. InChIKey: YMYPOEDCYSNBAO-LCAICKDSSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (2E,4E)-5-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpenta-2,4-dienal |
| InChIKey | YMYPOEDCYSNBAO-LCAICKDSSA-N |
| SMILES | CC1=C(C(CC(C1)O)(C)C)/C=C/C(=C/C=O)/C |
Computed by PubChem (NCBI)