CAS 35700-22-2 appears in our catalog under these names: 15(R)–15–methyl Prostaglandin F2α methyl ester, 15(R)-15-Methyl prostaglandin F2α methyl ester. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 500μg, Get quote.
Methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoate (CAS 35700-22-2) is a chemical compound with the molecular formula C22H38O5 and a molecular weight of 382.5 g/mol. IUPAC name: methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoate. InChIKey: QQCOAAFKJZXJFP-IFMFXUMGSA-N.
| Molecular formula | C22H38O5 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoate |
| InChIKey | QQCOAAFKJZXJFP-IFMFXUMGSA-N |
| SMILES | CCCCC[C@](C)(/C=C/[C@H]1[C@@H](C[C@@H]([C@@H]1C/C=C\CCCC(=O)OC)O)O)O |
Computed by PubChem (NCBI)