CAS 35700-52-8 appears in our catalog under these names: 5-Methoxy-2,3-dihydro-1-benzofuran-7-carboxylic acid, 95%, 5-Methoxy-2,3-dihydro-1-benzofuran-7-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-methoxy-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 35700-52-8) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 5-methoxy-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: SINHIGWJWUDRFQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 5-methoxy-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | SINHIGWJWUDRFQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)C(=O)O)OCC2 |
Computed by PubChem (NCBI)