CAS 35700-73-3 appears in our catalog under these names: 2,2,5-Trimethyl-2,3-dihydrobenzofuran-7-carboxylic acid, 95%, 95%, 2,2,5-Trimethyl-2,3-dihydrobenzofuran-7-carboxylic acid, 98%, 2,2,5-Trimethyl-2,3-dihydrobenzofuran-7-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,2,5-trimethyl-3H-1-benzofuran-7-carboxylic acid (CAS 35700-73-3) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2,2,5-trimethyl-3H-1-benzofuran-7-carboxylic acid. InChIKey: IZWOJXGLGRGZNL-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2,2,5-trimethyl-3H-1-benzofuran-7-carboxylic acid |
| InChIKey | IZWOJXGLGRGZNL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)C(=O)O)OC(C2)(C)C |
Computed by PubChem (NCBI)