Products 35764-59-1
CAS 35764-59-1 is the registry number for Cismethrin. Offered by: MedChemExpress. Available pack sizes: Get quote.
Trans-(5-benzylfuran-3-yl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (CAS 35764-59-1) is a chemical compound with the molecular formula C22H26O3 and a molecular weight of 338.4 g/mol. IUPAC name: trans-(5-benzylfuran-3-yl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate. InChIKey: VEMKTZHHVJILDY-PMACEKPBSA-N.
| Molecular formula | C22H26O3 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | trans-(5-benzylfuran-3-yl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| InChIKey | VEMKTZHHVJILDY-PMACEKPBSA-N |
| SMILES | CC(=C[C@H]1[C@H](C1(C)C)C(=O)OCC2=COC(=C2)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)