Products 3585-47-5
CAS 3585-47-5 appears in our catalog under these names: Ibuprofen Impurity 5, Ibuprofen impurity 1, Ibuprofen Impurity 31, a-Methyl-4-propylphenylacetic Acid, >95% (HPLC), 2-(4-n-Propylphenyl)propanoic Acid. Offered by: Chemat Brand, GLPBio, TRC, Mikromol, Chemat. Available pack sizes: on request, 5mg, 50mg, 25mg, 100mg, 5 mg, 10 mg.
2-(4-propylphenyl)propanoic acid (CAS 3585-47-5) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2-(4-propylphenyl)propanoic acid. InChIKey: DMJYWNOMDAPUTN-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 2-(4-propylphenyl)propanoic acid |
| InChIKey | DMJYWNOMDAPUTN-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C(C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
p-Propylhydratropic Acid, 2-(4-n-Propylphenyl)propionic Acid, Hydratropic acid, p-propyl-, 2-(p-Propylphenyl)propionic acid, alpha-Methyl-4-propylbenzeneacetic acid, Benzeneacetic acid, alpha-methyl-4-propyl-, 2-(4-propylphenyl)propanoic acid, Ibuprofen impurity 1, alpha-Methyl-4-propylphenylacetic Acid, a-Methyl-4-propylphenylacetic Acid