CAS 35891-75-9 appears in our catalog under these names: Prilocaine EP Impurity C HCl, Prilocaine Impurity 3(Prilocaine EP Impurity C), (RS)-2-Ethylamino-N-(2-methylphenyl)propanamide Hydrochloride, 2-(Ethylamino)-N-(o-tolyl)propanamide hydrochloride, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, Mikromol, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-(ethylamino)-N-(2-methylphenyl)propanamide;hydrochloride (CAS 35891-75-9) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: 2-(ethylamino)-N-(2-methylphenyl)propanamide;hydrochloride. InChIKey: FRFJZONNAIYUGR-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | 2-(ethylamino)-N-(2-methylphenyl)propanamide;hydrochloride |
| InChIKey | FRFJZONNAIYUGR-UHFFFAOYSA-N |
| SMILES | CCNC(C)C(=O)NC1=CC=CC=C1C.Cl |
Computed by PubChem (NCBI)