CAS 35891-84-0 appears in our catalog under these names: Lidocaine Impurity 8, N-(2,6-Dimethylphenyl)-2-(methylamino)acetamide hydrochloride, N-(2,6-Dimethylphenyl)-2-(methylamino)acetamide hydrochloride, 97%, 97%, N-(2,6-Dimethylphenyl)-2-(methylamino)acetamide hydrochloride, Lidocaine Impurity, 97%. Offered by: Chemat Brand, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 2,5g, 250mg, 100mg.
N-(2,6-dimethylphenyl)-2-(methylamino)acetamide;hydrochloride (CAS 35891-84-0) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-(methylamino)acetamide;hydrochloride. InChIKey: OZULDARSJSPCHT-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-(methylamino)acetamide;hydrochloride |
| InChIKey | OZULDARSJSPCHT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CNC.Cl |
Computed by PubChem (NCBI)