Products 35891-93-1
CAS 35891-93-1 appears in our catalog under these names: Tocainide hydrochloride, Tocainide.HCl, 98%. Offered by: TargetMol, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-N-(2,6-dimethylphenyl)propanamide;hydrochloride (CAS 35891-93-1) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: 2-amino-N-(2,6-dimethylphenyl)propanamide;hydrochloride. InChIKey: AMZACPWEJDQXGW-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | 2-amino-N-(2,6-dimethylphenyl)propanamide;hydrochloride |
| InChIKey | AMZACPWEJDQXGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C(C)N.Cl |
Computed by PubChem (NCBI)