CAS 35939-60-7 appears in our catalog under these names: 2-Amino-b-L-arabinofurano(1,2:4,5)oxazoline, 2-Amino-b-L-arabinofurano[1,2,4,5]oxazol, ine, 10 g, 2-Amino-b-L-arabinofurano[1,2,4,5]oxazol, ine, 25 g. Offered by: Biosynth, Roth. Available pack sizes: 25g, 10g, 50g, 100g.
(3aS,5S,6S,6aR)-2-amino-5-(hydroxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazol-6-ol (CAS 35939-60-7) is a chemical compound with the molecular formula C6H10N2O4 and a molecular weight of 174.15 g/mol. IUPAC name: (3aS,5S,6S,6aR)-2-amino-5-(hydroxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazol-6-ol. InChIKey: IVFVSTOFYHUJRU-KLVWXMOXSA-N.
| Molecular formula | C6H10N2O4 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | (3aS,5S,6S,6aR)-2-amino-5-(hydroxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazol-6-ol |
| InChIKey | IVFVSTOFYHUJRU-KLVWXMOXSA-N |
| SMILES | C([C@H]1[C@@H]([C@@H]2[C@H](O1)N=C(O2)N)O)O |
Computed by PubChem (NCBI)