CAS 35959-50-3 appears in our catalog under these names: 2',5'-Dideoxyuridine, >95% (HPLC), 2',5'-Dideoxyuridine, 2’,5’-Dideoxyuridine. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 25mg, 5 mg, 500 μg, 1 mg.
1-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione (CAS 35959-50-3) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione. InChIKey: FDCFKLBIAIKUKB-GKROBHDKSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | FDCFKLBIAIKUKB-GKROBHDKSA-N |
| SMILES | C[C@@H]1[C@H](C[C@@H](O1)N2C=CC(=O)NC2=O)O |
Computed by PubChem (NCBI)