Products 360-81-6
CAS 360-81-6 appears in our catalog under these names: Hydrochlorothiazide Impurity 8, Hydrochlorothiazide Impurity 19, 3-Methyl-2H-benzo[e][1,2,4]thiadiazine 1,1-dioxide, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 360-81-6) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: FDWRKMPNEIXNOE-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | FDWRKMPNEIXNOE-UHFFFAOYSA-N |
| SMILES | CC1=NS(=O)(=O)C2=CC=CC=C2N1 |
Computed by PubChem (NCBI)
Synonyms:
Mebetide, 2H-1,2,4-Benzothiadiazine, 3-methyl-, 1,1-dioxide, 3-methyl-4h-1,2,4-benzothiadiazine 1,1-dioxide, 3-Methyl-2H-1,2,4-benzothiadiazine 1,1-dioxide, 3-Methyl-2H-benzo[e][1,2,4]thiadiazine 1,1-dioxide, 3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide, Hydrochlorothiazide Impurity 19, Deschloro Diazoxide, 3-Metil-2H-1,2,4-benzotiodiazina 1,1-diossido [Italian], 3-Methyl-1,2,4-benzothiadiazine-1,1-dioxide