Products 360078-60-0
CAS 360078-60-0 is the registry number for 4-Amino-8-methyl-1,2-dihydroquinoline-2-thione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-8-methyl-1H-quinoline-2-thione (CAS 360078-60-0) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 4-amino-8-methyl-1H-quinoline-2-thione. InChIKey: HEUXZCNVPPDKRX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 4-amino-8-methyl-1H-quinoline-2-thione |
| InChIKey | HEUXZCNVPPDKRX-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=S)N2)N |
Computed by PubChem (NCBI)