CAS 36018-20-9 is the registry number for 3,4-Dimethylphenyl carbonochloridate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,4-dimethylphenyl) carbonochloridate (CAS 36018-20-9) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: (3,4-dimethylphenyl) carbonochloridate. InChIKey: WRQLVPIQNOJFQT-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | (3,4-dimethylphenyl) carbonochloridate |
| InChIKey | WRQLVPIQNOJFQT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC(=O)Cl)C |
Computed by PubChem (NCBI)