Products 36020-63-0
CAS 36020-63-0 is the registry number for FA-Phe-OMe. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
Methyl (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate (CAS 36020-63-0) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: methyl (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate. InChIKey: RQZWKQIIVBDCBL-FEAKQIBJSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | methyl (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate |
| InChIKey | RQZWKQIIVBDCBL-FEAKQIBJSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)/C=C/C2=CC=CO2 |
Computed by PubChem (NCBI)