Products 36037-36-2

CAS 36037-36-2 is the registry number for 3,5-Dimethylphenyl carbonochloridate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3,5-dimethylphenyl) carbonochloridate (CAS 36037-36-2) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: (3,5-dimethylphenyl) carbonochloridate. InChIKey: KLLAFPIQULNDBN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO2
Molecular weight184.62 g/mol
IUPAC name(3,5-dimethylphenyl) carbonochloridate
InChIKeyKLLAFPIQULNDBN-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)OC(=O)Cl)C

Computed by PubChem (NCBI)