CAS 36075-44-2 appears in our catalog under these names: 4-Hydrazinoquinazoline, 95%, 4-Hydrazinoquinazoline, 4-Hydrazinylquinazoline 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 2,5g, 100mg, 250mg.
Quinazolin-4-ylhydrazine (CAS 36075-44-2) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: quinazolin-4-ylhydrazine. InChIKey: QVKNQXCOGYNFPC-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | quinazolin-4-ylhydrazine |
| InChIKey | QVKNQXCOGYNFPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC=N2)NN |
Computed by PubChem (NCBI)