CAS 36097-42-4 appears in our catalog under these names: Ac-p-amino-phe-ome, 97%, Ac–p–amino–Phe–OMe, Ac-p-amino-Phe-OMe. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 2000mg, 10000mg.
Methyl (2S)-2-acetamido-3-(4-aminophenyl)propanoate (CAS 36097-42-4) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: methyl (2S)-2-acetamido-3-(4-aminophenyl)propanoate. InChIKey: DNSLMVHBZCGJNH-NSHDSACASA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | methyl (2S)-2-acetamido-3-(4-aminophenyl)propanoate |
| InChIKey | DNSLMVHBZCGJNH-NSHDSACASA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)N)C(=O)OC |
Computed by PubChem (NCBI)