Products 362049-65-8
CAS 362049-65-8 appears in our catalog under these names: 2-Propylpentanoic-d15 Acid, 98 atom % D, min 98% Chemical Purity, Valproic acid–d15, Valproic acid-d15, 99.80%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 5 mg, 10 mg.
2,3,3,4,4,5,5,5-octadeuterio-2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pentanoic acid (CAS 362049-65-8) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 159.30 g/mol. IUPAC name: 2,3,3,4,4,5,5,5-octadeuterio-2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pentanoic acid. InChIKey: NIJJYAXOARWZEE-BKUSUEPDSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 159.30 g/mol |
| IUPAC name | 2,3,3,4,4,5,5,5-octadeuterio-2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pentanoic acid |
| InChIKey | NIJJYAXOARWZEE-BKUSUEPDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)