CAS 87745-18-4 appears in our catalog under these names: Valproic Acid-d6, 2-(Propyl-3,3,3-d3)pentanoic-5,5,5-d3 Acid, 99 atom % D, min 98% Chemical Purity, Valproic Acid-d6, >95% (GC), Valproic acid-D6, 0.1mg/ml in Methanol, Valproic acid-D6, 1mg/ml in Methanol. Offered by: Chemat Brand, CDN, TRC, Lipomed, GLPBio. Available pack sizes: on request, 0,05g, 0,01g, 50mg, 5mg, 100mg, 10mg, 1ml.
5,5,5-trideuterio-2-(3,3,3-trideuteriopropyl)pentanoic acid (CAS 87745-18-4) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 150.25 g/mol. IUPAC name: 5,5,5-trideuterio-2-(3,3,3-trideuteriopropyl)pentanoic acid. InChIKey: NIJJYAXOARWZEE-WFGJKAKNSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 150.25 g/mol |
| IUPAC name | 5,5,5-trideuterio-2-(3,3,3-trideuteriopropyl)pentanoic acid |
| InChIKey | NIJJYAXOARWZEE-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])CCC(CCC([2H])([2H])[2H])C(=O)O |
Computed by PubChem (NCBI)