Products 87745-17-3
CAS 87745-17-3 appears in our catalog under these names: Valproic Acid-d4, 2-(Propyl-1,1-d2)pentanoic-3,3-d2 Acid, 99 atom % D, min 98% Chemical Purity, Valproic Acid-d4, >95% (GC), Valproic acid-d4, 98.0%. Offered by: Chemat Brand, CDN, TRC, MedChemExpress. Available pack sizes: on request, 0,05g, 0,01g, 10mg, 1mg, 10 mg, 1 mg, 5 mg.
3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoic acid (CAS 87745-17-3) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 148.24 g/mol. IUPAC name: 3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoic acid. InChIKey: NIJJYAXOARWZEE-NZLXMSDQSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 148.24 g/mol |
| IUPAC name | 3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoic acid |
| InChIKey | NIJJYAXOARWZEE-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(CC)C(C(=O)O)C([2H])([2H])CC |
Computed by PubChem (NCBI)