Products 36231-81-9
CAS 36231-81-9 is the registry number for ethyl 5-amino-2-phenyl-1,3-oxazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 5-amino-2-phenyl-1,3-oxazole-4-carboxylate (CAS 36231-81-9) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: ethyl 5-amino-2-phenyl-1,3-oxazole-4-carboxylate. InChIKey: CVCNAHPOWFVTKQ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | ethyl 5-amino-2-phenyl-1,3-oxazole-4-carboxylate |
| InChIKey | CVCNAHPOWFVTKQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)