Products 36287-37-3
CAS 36287-37-3 is the registry number for DBB–7373. Offered by: GLPBio. Available pack sizes: 10mg, 100mg, 200mg, 25mg, 5mg, 50mg.
(2R,3S)-1,4-bis(3,4-dimethoxyphenyl)-2,3-dimethylbutane-1,4-dione (CAS 36287-37-3) is a chemical compound with the molecular formula C22H26O6 and a molecular weight of 386.4 g/mol. IUPAC name: (2R,3S)-1,4-bis(3,4-dimethoxyphenyl)-2,3-dimethylbutane-1,4-dione. InChIKey: SPBNPRXRUYBFDV-OKILXGFUSA-N.
| Molecular formula | C22H26O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (2R,3S)-1,4-bis(3,4-dimethoxyphenyl)-2,3-dimethylbutane-1,4-dione |
| InChIKey | SPBNPRXRUYBFDV-OKILXGFUSA-N |
| SMILES | C[C@H]([C@H](C)C(=O)C1=CC(=C(C=C1)OC)OC)C(=O)C2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)