CAS 363-64-4 is the registry number for 1,3,5-Trifluoro-2,4,6-trimethylbenzene, 98+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
1,3,5-trifluoro-2,4,6-trimethylbenzene (CAS 363-64-4) is a chemical compound with the molecular formula C9H9F3 and a molecular weight of 174.16 g/mol. IUPAC name: 1,3,5-trifluoro-2,4,6-trimethylbenzene. InChIKey: AWOTVEDDCKYHRO-UHFFFAOYSA-N.
| Molecular formula | C9H9F3 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,3,5-trifluoro-2,4,6-trimethylbenzene |
| InChIKey | AWOTVEDDCKYHRO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)C)F)C)F |
Computed by PubChem (NCBI)