CAS 36367-85-8 is the registry number for 3–Cyclopenten–1–ol, 4–methylbenzenesulfonate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Cyclopent-3-en-1-yl 4-methylbenzenesulfonate (CAS 36367-85-8) is a chemical compound with the molecular formula C12H14O3S and a molecular weight of 238.30 g/mol. IUPAC name: cyclopent-3-en-1-yl 4-methylbenzenesulfonate. InChIKey: RRAUUFGVZBARFB-UHFFFAOYSA-N.
| Molecular formula | C12H14O3S |
|---|---|
| Molecular weight | 238.30 g/mol |
| IUPAC name | cyclopent-3-en-1-yl 4-methylbenzenesulfonate |
| InChIKey | RRAUUFGVZBARFB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CC=CC2 |
Computed by PubChem (NCBI)